Products 1820712-08-0
CAS 1820712-08-0 is the registry number for tert-Butyl 3-bromo-6-(hydroxymethyl)-1h-indole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Tert-butyl 3-bromo-6-(hydroxymethyl)indole-1-carboxylate (CAS 1820712-08-0) is a chemical compound with the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. IUPAC name: tert-butyl 3-bromo-6-(hydroxymethyl)indole-1-carboxylate. InChIKey: CFHHUIOLYDNDSU-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO3 |
|---|---|
| Molecular weight | 326.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-6-(hydroxymethyl)indole-1-carboxylate |
| InChIKey | CFHHUIOLYDNDSU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C2=C1C=C(C=C2)CO)Br |
Computed by PubChem (NCBI)