Products 312279-64-4
CAS 312279-64-4 is the registry number for 5-Bromo-2-(cyclohexanecarboxamido)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-2-(cyclohexanecarbonylamino)benzoic acid (CAS 312279-64-4) is a chemical compound with the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. IUPAC name: 5-bromo-2-(cyclohexanecarbonylamino)benzoic acid. InChIKey: ZLAFDAGXBATNNP-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO3 |
|---|---|
| Molecular weight | 326.19 g/mol |
| IUPAC name | 5-bromo-2-(cyclohexanecarbonylamino)benzoic acid |
| InChIKey | ZLAFDAGXBATNNP-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)NC2=C(C=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)