CAS 107313-17-7 appears in our catalog under these names: Methyl (1r,2r)-rel-2-aminocyclohexane-1-carboxylate hydrochloride, 95%, trans-Methyl 2-aminocyclohexanecarboxylate hydrochloride, 97%, methyl (1R,2R)-rel-2-aminocyclohexane-1-carboxylate hydrochloride, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 250mg, 5g, 10g, 100mg.
Trans-methyl (1S,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride (CAS 107313-17-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1S,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: PYKBWUZZPSEGLC-LEUCUCNGSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1S,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | PYKBWUZZPSEGLC-LEUCUCNGSA-N |
| SMILES | COC(=O)[C@H]1CCCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)