CAS 948915-94-4 appears in our catalog under these names: (1S,2S)-Methyl 2-aminocyclohexane carboxylate hydrochloride, 95%, (1S,2S)-Methyl 2-aminocyclohexanecarboxylate hydrochloride, 97%, (1S,2S)-Methyl 2-aminocyclohexanecarboxylate hydrochloride, (1S,2S)-METHYL 2-AMINOCYCLOHEXANECARBOXYLATE HYDROCHLORIDE, 97%, 97%, (1S,2S)-METHYL 2-AMINOCYCLOHEXANE CARBOXYLATE HCL, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 50mg, 0,5g, 100mg, 500mg.
Trans-methyl (1S,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride (CAS 948915-94-4) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: trans-methyl (1S,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride. InChIKey: PYKBWUZZPSEGLC-LEUCUCNGSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | trans-methyl (1S,2S)-2-aminocyclohexane-1-carboxylate;hydrochloride |
| InChIKey | PYKBWUZZPSEGLC-LEUCUCNGSA-N |
| SMILES | COC(=O)[C@H]1CCCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)