CAS 1073354-57-0 appears in our catalog under these names: trans-3-Cyclopentylpropen-1-ylboronic acid, pinacol ester, 95%, TRANS–2–(3–CYCLOPENTYLPROPEN–1–YL)–4,4,5,5–TETRAMETHYL–1,3,2–DIOXABOROLANE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
2-[(E)-3-cyclopentylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073354-57-0) is a chemical compound with the molecular formula C14H25BO2 and a molecular weight of 236.16 g/mol. IUPAC name: 2-[(E)-3-cyclopentylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GXNIAKZVBGUMHU-YRNVUSSQSA-N.
| Molecular formula | C14H25BO2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 2-[(E)-3-cyclopentylprop-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GXNIAKZVBGUMHU-YRNVUSSQSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CC2CCCC2 |
Computed by PubChem (NCBI)