Products 2609867-63-0
CAS 2609867-63-0 is the registry number for 4,4,5,5-Tetramethyl-2-(4-methylbicyclo[2.2.1]heptan-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-(4-methyl-1-bicyclo[2.2.1]heptanyl)-1,3,2-dioxaborolane (CAS 2609867-63-0) is a chemical compound with the molecular formula C14H25BO2 and a molecular weight of 236.16 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-methyl-1-bicyclo[2.2.1]heptanyl)-1,3,2-dioxaborolane. InChIKey: IOQNSECGKYUNNN-UHFFFAOYSA-N.
| Molecular formula | C14H25BO2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-methyl-1-bicyclo[2.2.1]heptanyl)-1,3,2-dioxaborolane |
| InChIKey | IOQNSECGKYUNNN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C23CCC(C2)(CC3)C |
Computed by PubChem (NCBI)