CAS 2762306-59-0 is the registry number for 2-(Bicyclo(2.2.2)octan-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
2-(1-bicyclo[2.2.2]octanyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2762306-59-0) is a chemical compound with the molecular formula C14H25BO2 and a molecular weight of 236.16 g/mol. IUPAC name: 2-(1-bicyclo[2.2.2]octanyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HWXYCVMIRVJFBE-UHFFFAOYSA-N.
| Molecular formula | C14H25BO2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 2-(1-bicyclo[2.2.2]octanyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HWXYCVMIRVJFBE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C23CCC(CC2)CC3 |
Computed by PubChem (NCBI)