CAS 1073354-78-5 is the registry number for 2-(Methylthio)pyridine-3-boronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methylsulfanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1073354-78-5) is a chemical compound with the molecular formula C12H18BNO2S and a molecular weight of 251.16 g/mol. IUPAC name: 2-methylsulfanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: LZOBOHRLTCNJHH-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2S |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | 2-methylsulfanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | LZOBOHRLTCNJHH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=CC=C2)SC |
Computed by PubChem (NCBI)