CAS 1283179-55-4 appears in our catalog under these names: 2-(Cyclopropyl)thiazole-4-boronic acid pinacol ester, 97%, 2-Cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazole, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 5g, 1g, 250mg.
2-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole (CAS 1283179-55-4) is a chemical compound with the molecular formula C12H18BNO2S and a molecular weight of 251.16 g/mol. IUPAC name: 2-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole. InChIKey: RSJUPZNMQAPYEX-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2S |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | 2-cyclopropyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole |
| InChIKey | RSJUPZNMQAPYEX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=N2)C3CC3 |
Computed by PubChem (NCBI)