CAS 1171891-40-9 appears in our catalog under these names: 5-(Methylthio)pyridine-3-boronic acid pinacol ester, ≥95%, ≥95%, 5-(Methylthio)pyridine-3-boronic acid pinacol ester, ≥95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
3-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1171891-40-9) is a chemical compound with the molecular formula C12H18BNO2S and a molecular weight of 251.16 g/mol. IUPAC name: 3-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QHBCHGQQPYKHEQ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO2S |
|---|---|
| Molecular weight | 251.16 g/mol |
| IUPAC name | 3-methylsulfanyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | QHBCHGQQPYKHEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)SC |
Computed by PubChem (NCBI)