CAS 1334402-96-8 is the registry number for 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-(phenylmethyl)phenyl)-, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(2-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1334402-96-8) is a chemical compound with the molecular formula C19H23BO2 and a molecular weight of 294.2 g/mol. IUPAC name: 2-(2-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZAOSQONQDFXLBF-UHFFFAOYSA-N.
| Molecular formula | C19H23BO2 |
|---|---|
| Molecular weight | 294.2 g/mol |
| IUPAC name | 2-(2-benzylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZAOSQONQDFXLBF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2CC3=CC=CC=C3 |
Computed by PubChem (NCBI)