Products 1073608-18-0
CAS 1073608-18-0 is the registry number for 5-Chloro-N-cyclohexylpentanamide-d11. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
5-chloro-N-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pentanamide (CAS 1073608-18-0) is a chemical compound with the molecular formula C11H20ClNO and a molecular weight of 228.80 g/mol. IUPAC name: 5-chloro-N-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pentanamide. InChIKey: OBOBOCFRZMDIDG-BMWRUFNQSA-N.
| Molecular formula | C11H20ClNO |
|---|---|
| Molecular weight | 228.80 g/mol |
| IUPAC name | 5-chloro-N-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)pentanamide |
| InChIKey | OBOBOCFRZMDIDG-BMWRUFNQSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])NC(=O)CCCCCl)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)