Products 953807-01-7

CAS 953807-01-7 is the registry number for 2-Chloro-n-(2,3-dimethylcyclohexyl)propanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-N-(2,3-dimethylcyclohexyl)propanamide (CAS 953807-01-7) is a chemical compound with the molecular formula C11H20ClNO and a molecular weight of 217.73 g/mol. IUPAC name: 2-chloro-N-(2,3-dimethylcyclohexyl)propanamide. InChIKey: NIRDDXXHNBLIBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H20ClNO
Molecular weight217.73 g/mol
IUPAC name2-chloro-N-(2,3-dimethylcyclohexyl)propanamide
InChIKeyNIRDDXXHNBLIBQ-UHFFFAOYSA-N
SMILESCC1CCCC(C1C)NC(=O)C(C)Cl

Computed by PubChem (NCBI)