Products 128487-54-7
CAS 128487-54-7 is the registry number for 3-(Aminomethyl)adamantan-1-ol HCl. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
3-(aminomethyl)adamantan-1-ol;hydrochloride (CAS 128487-54-7) is a chemical compound with the molecular formula C11H20ClNO and a molecular weight of 217.73 g/mol. IUPAC name: 3-(aminomethyl)adamantan-1-ol;hydrochloride. InChIKey: FELRDAQSQLZIHE-UHFFFAOYSA-N.
| Molecular formula | C11H20ClNO |
|---|---|
| Molecular weight | 217.73 g/mol |
| IUPAC name | 3-(aminomethyl)adamantan-1-ol;hydrochloride |
| InChIKey | FELRDAQSQLZIHE-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)O)CN.Cl |
Computed by PubChem (NCBI)