CAS 1073634-13-5 appears in our catalog under these names: 3,5-Difluoro-2-nitropyridine, 95%, 3,5–Difluoro–2–nitropyridine, 3,5-Difluoro-2-nitropyridine 95%, 3,5-Difluoro-2-nitropyridine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
3,5-difluoro-2-nitropyridine (CAS 1073634-13-5) is a chemical compound with the molecular formula C5H2F2N2O2 and a molecular weight of 160.08 g/mol. IUPAC name: 3,5-difluoro-2-nitropyridine. InChIKey: ZNMBOZBJKBSSFZ-UHFFFAOYSA-N.
| Molecular formula | C5H2F2N2O2 |
|---|---|
| Molecular weight | 160.08 g/mol |
| IUPAC name | 3,5-difluoro-2-nitropyridine |
| InChIKey | ZNMBOZBJKBSSFZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)