CAS 60186-15-4 appears in our catalog under these names: 2,4-Difluoro-5-nitropyridine, 96%, 2,4-Difluoro-5-nitropyridine 95%, 2,4-Difluoro-5-nitropyridine, 95%, 95%, 2,4-Difluoro-5-nitropyridine, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2,4-difluoro-5-nitropyridine (CAS 60186-15-4) is a chemical compound with the molecular formula C5H2F2N2O2 and a molecular weight of 160.08 g/mol. IUPAC name: 2,4-difluoro-5-nitropyridine. InChIKey: OLPMWQXRTRVQRS-UHFFFAOYSA-N.
| Molecular formula | C5H2F2N2O2 |
|---|---|
| Molecular weight | 160.08 g/mol |
| IUPAC name | 2,4-difluoro-5-nitropyridine |
| InChIKey | OLPMWQXRTRVQRS-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)