CAS 1807176-11-9 appears in our catalog under these names: 2,6-Difluoro-4-nitropyridine, 97%, 2,6-Difluoro-4-nitropyridine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-difluoro-4-nitropyridine (CAS 1807176-11-9) is a chemical compound with the molecular formula C5H2F2N2O2 and a molecular weight of 160.08 g/mol. IUPAC name: 2,6-difluoro-4-nitropyridine. InChIKey: SECYBHQWKXUPOB-UHFFFAOYSA-N.
| Molecular formula | C5H2F2N2O2 |
|---|---|
| Molecular weight | 160.08 g/mol |
| IUPAC name | 2,6-difluoro-4-nitropyridine |
| InChIKey | SECYBHQWKXUPOB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)