CAS 107382-52-5 is the registry number for (E)-Norgestimate. Offered by: Chemat Brand. Available pack sizes: on request.
Norgestimate is a ketoxime, a steroid ester and a terminal acetylenic compound. It has a role as a contraceptive drug, a synthetic oral contraceptive and a progestin.
Source: ChEBI
| Molecular formula | C23H31NO3 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | [(3E,8R,9S,10R,13S,14S,17R)-13-ethyl-17-ethynyl-3-hydroxyimino-1,2,6,7,8,9,10,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl] acetate |
| InChIKey | KIQQMECNKUGGKA-NMYWJIRASA-N |
| SMILES | CC[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@]2(C#C)OC(=O)C)CCC4=C/C(=N/O)/CC[C@H]34 |
Computed by PubChem (NCBI)