Products 1294517-17-1
CAS 1294517-17-1 is the registry number for (S)-N,N-Diisopropyl-3-((5-methoxycarbonyl)-2-hydroxy)phenyl)-3-phenyl-propylamine. Offered by: TRC. Available pack sizes: 100mg.
Methyl 3-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoate (CAS 1294517-17-1) is a chemical compound with the molecular formula C23H31NO3 and a molecular weight of 369.5 g/mol. IUPAC name: methyl 3-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoate. InChIKey: LAPCBEFVTNSDFY-FQEVSTJZSA-N.
| Molecular formula | C23H31NO3 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | methyl 3-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoate |
| InChIKey | LAPCBEFVTNSDFY-FQEVSTJZSA-N |
| SMILES | CC(C)N(CC[C@@H](C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)OC)O)C(C)C |
Computed by PubChem (NCBI)