CAS 214601-17-9 appears in our catalog under these names: 3-((1R)-3-(bis(1-methylethyl)amino)-1-phenylpropyl)-4-hydroxy-Benzoic acid methyl ester, 98%, 3-[(1R)-3-[Bis(1-Methylethyl)Amino]-1-Phenylpropyl]-4-Hydroxy-Benzoic Acid Methyl Ester, 98%, 98%, 3-[(1R)-3-[bis(1-methylethyl)amino]-1-phenylpropyl]-4-hydroxy-Benzoic acid methyl ester, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Methyl 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoate (CAS 214601-17-9) is a chemical compound with the molecular formula C23H31NO3 and a molecular weight of 369.5 g/mol. IUPAC name: methyl 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoate. InChIKey: LAPCBEFVTNSDFY-HXUWFJFHSA-N.
| Molecular formula | C23H31NO3 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | methyl 3-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-hydroxybenzoate |
| InChIKey | LAPCBEFVTNSDFY-HXUWFJFHSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)C(=O)OC)O)C(C)C |
Computed by PubChem (NCBI)