CAS 107382-62-7 is the registry number for Rel-(1R,2S,8aS)-octahydroindolizine-1,2-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol (CAS 107382-62-7) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (1R,2S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol. InChIKey: SQECYPINZNWUTE-BIIVOSGPSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (1R,2S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
| InChIKey | SQECYPINZNWUTE-BIIVOSGPSA-N |
| SMILES | C1CCN2C[C@@H]([C@@H]([C@@H]2C1)O)O |
Computed by PubChem (NCBI)