CAS 125279-72-3 appears in our catalog under these names: (-)-Lentiginosine, min. 95 %, 5 mg, (1R,2R,8AR)-octahydroindolizine-1,2-diol, 97%, (-)-Lentiginosine, >95% (HPLC), Lentiginosine, (-)-Lentiginosine. Offered by: Roth, Chemat Brand, TRC, TargetMol, Biosynth. Available pack sizes: 5mg, on request, 0,5mg, 1mg, 2,5mg, 25mg, 50mg, 100mg.
(1R,2R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol (CAS 125279-72-3) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: (1R,2R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol. InChIKey: SQECYPINZNWUTE-BWZBUEFSSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | (1R,2R,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2-diol |
| InChIKey | SQECYPINZNWUTE-BWZBUEFSSA-N |
| SMILES | C1CCN2C[C@H]([C@@H]([C@H]2C1)O)O |
Computed by PubChem (NCBI)