CAS 107430-45-5 is the registry number for F 2833. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-(2-chlorophenyl)phenyl]propan-2-ol (CAS 107430-45-5) is a chemical compound with the molecular formula C15H15ClO and a molecular weight of 246.73 g/mol. IUPAC name: 2-[4-(2-chlorophenyl)phenyl]propan-2-ol. InChIKey: VILCOLBQTAITPH-UHFFFAOYSA-N.
| Molecular formula | C15H15ClO |
|---|---|
| Molecular weight | 246.73 g/mol |
| IUPAC name | 2-[4-(2-chlorophenyl)phenyl]propan-2-ol |
| InChIKey | VILCOLBQTAITPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)C2=CC=CC=C2Cl)O |
Computed by PubChem (NCBI)