CAS 1266406-64-7 is the registry number for 1-Chloro-3,5-dimethyl-2-(phenylmethoxy)benzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloro-3,5-dimethyl-2-phenylmethoxybenzene (CAS 1266406-64-7) is a chemical compound with the molecular formula C15H15ClO and a molecular weight of 246.73 g/mol. IUPAC name: 1-chloro-3,5-dimethyl-2-phenylmethoxybenzene. InChIKey: GRTIRVMXTNURJB-UHFFFAOYSA-N.
| Molecular formula | C15H15ClO |
|---|---|
| Molecular weight | 246.73 g/mol |
| IUPAC name | 1-chloro-3,5-dimethyl-2-phenylmethoxybenzene |
| InChIKey | GRTIRVMXTNURJB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)C |
Computed by PubChem (NCBI)