Products 1928573-83-4
CAS 1928573-83-4 is the registry number for 3-Chloro-α,4-dimethyl-α-phenylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(3-chloro-4-methylphenyl)-1-phenylethanol (CAS 1928573-83-4) is a chemical compound with the molecular formula C15H15ClO and a molecular weight of 246.73 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)-1-phenylethanol. InChIKey: UUUFBRWYXZLLHE-UHFFFAOYSA-N.
| Molecular formula | C15H15ClO |
|---|---|
| Molecular weight | 246.73 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)-1-phenylethanol |
| InChIKey | UUUFBRWYXZLLHE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)(C2=CC=CC=C2)O)Cl |
Computed by PubChem (NCBI)