CAS 107445-22-7 appears in our catalog under these names: (E)-[1-(pyridin-4-yl)ethylidene]amino 4-methylbenzene-1-sulfonate, 95%, (E)-(1-(Pyridin-4-yl)ethylidene)amino 4-methylbenzene-1-sulfonate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
[(E)-1-pyridin-4-ylethylideneamino] 4-methylbenzenesulfonate (CAS 107445-22-7) is a chemical compound with the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. IUPAC name: [(E)-1-pyridin-4-ylethylideneamino] 4-methylbenzenesulfonate. InChIKey: GOBHWEKJWDUUQS-FOWTUZBSSA-N.
| Molecular formula | C14H14N2O3S |
|---|---|
| Molecular weight | 290.34 g/mol |
| IUPAC name | [(E)-1-pyridin-4-ylethylideneamino] 4-methylbenzenesulfonate |
| InChIKey | GOBHWEKJWDUUQS-FOWTUZBSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O/N=C(\C)/C2=CC=NC=C2 |
Computed by PubChem (NCBI)