CAS 325471-38-3 appears in our catalog under these names: 4-[(5-Methyl-4-phenyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid, 95%, 4-((5-Methyl-4-phenyl-1,3-thiazol-2-yl)amino)-4-oxobutanoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 10g, 5g, 1g, 50mg, 0,5g.
4-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid (CAS 325471-38-3) is a chemical compound with the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. IUPAC name: 4-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid. InChIKey: JTYCTMALSUYMEF-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3S |
|---|---|
| Molecular weight | 290.34 g/mol |
| IUPAC name | 4-[(5-methyl-4-phenyl-1,3-thiazol-2-yl)amino]-4-oxobutanoic acid |
| InChIKey | JTYCTMALSUYMEF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)NC(=O)CCC(=O)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)