CAS 92192-05-7 is the registry number for N-(3-Acetylphenyl)-4-aminobenzenesulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-acetylphenyl)-4-aminobenzenesulfonamide (CAS 92192-05-7) is a chemical compound with the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. IUPAC name: N-(3-acetylphenyl)-4-aminobenzenesulfonamide. InChIKey: GLQRCAIHYINMRS-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O3S |
|---|---|
| Molecular weight | 290.34 g/mol |
| IUPAC name | N-(3-acetylphenyl)-4-aminobenzenesulfonamide |
| InChIKey | GLQRCAIHYINMRS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)