CAS 107449-34-3 is the registry number for 2-Phenoxypropanoyl Chloride-d5. Offered by: TRC. Available pack sizes: 25mg.
2-(2,3,4,5,6-pentadeuteriophenoxy)propanoyl chloride (CAS 107449-34-3) is a chemical compound with the molecular formula C9H9ClO2 and a molecular weight of 189.65 g/mol. IUPAC name: 2-(2,3,4,5,6-pentadeuteriophenoxy)propanoyl chloride. InChIKey: BDSSZTXPZHIYHM-VIQYUKPQSA-N.
| Molecular formula | C9H9ClO2 |
|---|---|
| Molecular weight | 189.65 g/mol |
| IUPAC name | 2-(2,3,4,5,6-pentadeuteriophenoxy)propanoyl chloride |
| InChIKey | BDSSZTXPZHIYHM-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])OC(C)C(=O)Cl)[2H])[2H] |
Computed by PubChem (NCBI)