CAS 107450-28-2 is the registry number for 5-Chloro-4-methyl-1H-pyrazolo[3,4-b]pyridine-3,6-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4-methyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine (CAS 107450-28-2) is a chemical compound with the molecular formula C7H8ClN5 and a molecular weight of 197.62 g/mol. IUPAC name: 5-chloro-4-methyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine. InChIKey: WMPJQGCRVQHQGF-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN5 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 5-chloro-4-methyl-2H-pyrazolo[3,4-b]pyridine-3,6-diamine |
| InChIKey | WMPJQGCRVQHQGF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NNC(=C12)N)N)Cl |
Computed by PubChem (NCBI)