CAS 1803610-25-4 appears in our catalog under these names: 1-(Pyridin-4-yl)-1H-1,2,4-triazol-5-amine hydrochloride, 95%, 1-(Pyridin-4-yl)-1H-1,2,4-triazol-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-pyridin-4-yl-1,2,4-triazol-3-amine;hydrochloride (CAS 1803610-25-4) is a chemical compound with the molecular formula C7H8ClN5 and a molecular weight of 197.62 g/mol. IUPAC name: 2-pyridin-4-yl-1,2,4-triazol-3-amine;hydrochloride. InChIKey: GPTYUSYFXROCCY-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN5 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 2-pyridin-4-yl-1,2,4-triazol-3-amine;hydrochloride |
| InChIKey | GPTYUSYFXROCCY-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1N2C(=NC=N2)N.Cl |
Computed by PubChem (NCBI)