CAS 19255-48-2 appears in our catalog under these names: 9–(2–Chloroethyl)–9H–purin–6–amine, 9-(2-Chloro-ethyl)-9H-purin-6-ylamine, 98%, 9-(2-Chloro-ethyl)-9H-purin-6-ylamine, >95% (HPLC). Offered by: GLPBio, Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 25g, 5g, 10g, 2g, 500mg.
9-(2-chloroethyl)purin-6-amine (CAS 19255-48-2) is a chemical compound with the molecular formula C7H8ClN5 and a molecular weight of 197.62 g/mol. IUPAC name: 9-(2-chloroethyl)purin-6-amine. InChIKey: KXIXGDZXYORBNW-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN5 |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 9-(2-chloroethyl)purin-6-amine |
| InChIKey | KXIXGDZXYORBNW-UHFFFAOYSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)CCCl)N |
Computed by PubChem (NCBI)