CAS 107474-66-8 appears in our catalog under these names: 6-tert-Butyl 2-methyl 7,8-dihydropyrrolo-[3,2-e]indole-2,6(3h)-dicarboxylate, 95%, 6–tert–butyl 2–methyl 7,8–dihydropyrrolo(3,2–e)indole–2,6(3H)–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-O-tert-butyl 2-O-methyl 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate (CAS 107474-66-8) is a chemical compound with the molecular formula C17H20N2O4 and a molecular weight of 316.35 g/mol. IUPAC name: 6-O-tert-butyl 2-O-methyl 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate. InChIKey: MIZUMQMOWWRMIR-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O4 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | 6-O-tert-butyl 2-O-methyl 7,8-dihydro-3H-pyrrolo[3,2-e]indole-2,6-dicarboxylate |
| InChIKey | MIZUMQMOWWRMIR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC3=C2C=C(N3)C(=O)OC |
Computed by PubChem (NCBI)