CAS 1170285-76-3 is the registry number for 4-[(4-Cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid (CAS 1170285-76-3) is a chemical compound with the molecular formula C17H20N2O4 and a molecular weight of 316.35 g/mol. IUPAC name: 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid. InChIKey: UUBCQGPYAOAEMS-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O4 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid |
| InChIKey | UUBCQGPYAOAEMS-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2CCN(C(=O)C2=O)CC3=CC=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)