Products 1170285-76-3

CAS 1170285-76-3 is the registry number for 4-[(4-Cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid (CAS 1170285-76-3) is a chemical compound with the molecular formula C17H20N2O4 and a molecular weight of 316.35 g/mol. IUPAC name: 4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid. InChIKey: UUBCQGPYAOAEMS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20N2O4
Molecular weight316.35 g/mol
IUPAC name4-[(4-cyclopentyl-2,3-dioxopiperazin-1-yl)methyl]benzoic acid
InChIKeyUUBCQGPYAOAEMS-UHFFFAOYSA-N
SMILESC1CCC(C1)N2CCN(C(=O)C2=O)CC3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)