CAS 300715-96-2 is the registry number for 1,3,4,5-Tetrahydro-pyrido[4,3-b]indole-2,8-dicarboxylic acid 2-tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid (CAS 300715-96-2) is a chemical compound with the molecular formula C17H20N2O4 and a molecular weight of 316.35 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid. InChIKey: LCLGLPDRQJBJET-UHFFFAOYSA-N.
| Molecular formula | C17H20N2O4 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid |
| InChIKey | LCLGLPDRQJBJET-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)