CAS 107484-81-1 is the registry number for 5,6,9,10-Tetrahydro-4H,8H-pyrido[3,2,1-ij][1,6]naphthyridin-8-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-2-one (CAS 107484-81-1) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: 1,7-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-2-one. InChIKey: LPIQATAQJHMRML-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | 1,7-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8-trien-2-one |
| InChIKey | LPIQATAQJHMRML-UHFFFAOYSA-N |
| SMILES | C1CC2=CN=CC3=C2N(C1)C(=O)CC3 |
Computed by PubChem (NCBI)