CAS 1075754-39-0 appears in our catalog under these names: Methyl 3',5'-dimethyl-[1,1'-biphenyl]-4-carboxylate, 95%, Methyl 3',5'-dimethyl-(1,1'-biphenyl)-4-carboxylate, 98%, Methyl 3',5'-dimethyl-[1,1'-biphenyl]-4-carboxylate, ≥95%, ≥95%, Methyl 3',5'-dimethyl-[1,1'-biphenyl]-4-carboxylate. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 4-(3,5-dimethylphenyl)benzoate (CAS 1075754-39-0) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: methyl 4-(3,5-dimethylphenyl)benzoate. InChIKey: URXLZYDSTQUMBR-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | methyl 4-(3,5-dimethylphenyl)benzoate |
| InChIKey | URXLZYDSTQUMBR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=CC=C(C=C2)C(=O)OC)C |
Computed by PubChem (NCBI)