CAS 107599-99-5 is the registry number for (4R,5S) 4-Methyl-3-(3-methyl-butyryl)-5-phenyl-oxazolidin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4R,5S)-4-methyl-3-(3-methylbutanoyl)-5-phenyl-1,3-oxazolidin-2-one (CAS 107599-99-5) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (4R,5S)-4-methyl-3-(3-methylbutanoyl)-5-phenyl-1,3-oxazolidin-2-one. InChIKey: DRVYMRBXCGWILR-BXUZGUMPSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (4R,5S)-4-methyl-3-(3-methylbutanoyl)-5-phenyl-1,3-oxazolidin-2-one |
| InChIKey | DRVYMRBXCGWILR-BXUZGUMPSA-N |
| SMILES | C[C@@H]1[C@@H](OC(=O)N1C(=O)CC(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)