CAS 1076196-97-8 is the registry number for Boc-5-amino-2,4-dimethoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1076196-97-8) is a chemical compound with the molecular formula C14H19NO6 and a molecular weight of 297.30 g/mol. IUPAC name: 2,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: BPGFLVCLNXDUQV-UHFFFAOYSA-N.
| Molecular formula | C14H19NO6 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 2,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | BPGFLVCLNXDUQV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C(=C1)C(=O)O)OC)OC |
Computed by PubChem (NCBI)