Products 1076196-97-8

CAS 1076196-97-8 is the registry number for Boc-5-amino-2,4-dimethoxy-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1076196-97-8) is a chemical compound with the molecular formula C14H19NO6 and a molecular weight of 297.30 g/mol. IUPAC name: 2,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: BPGFLVCLNXDUQV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO6
Molecular weight297.30 g/mol
IUPAC name2,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
InChIKeyBPGFLVCLNXDUQV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=C(C(=C1)C(=O)O)OC)OC

Computed by PubChem (NCBI)