Products 502842-10-6

CAS 502842-10-6 is the registry number for Ethyl 3-amino-3-(2-methylphenyl)propanoate oxalate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-3-(2-methylphenyl)propanoate;oxalic acid (CAS 502842-10-6) is a chemical compound with the molecular formula C14H19NO6 and a molecular weight of 297.30 g/mol. IUPAC name: ethyl 3-amino-3-(2-methylphenyl)propanoate;oxalic acid. InChIKey: TZAPJRFLLVSPLK-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO6
Molecular weight297.30 g/mol
IUPAC nameethyl 3-amino-3-(2-methylphenyl)propanoate;oxalic acid
InChIKeyTZAPJRFLLVSPLK-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C1=CC=CC=C1C)N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)