CAS 2229299-38-9 is the registry number for 3-((tert-Butoxycarbonyl)amino)-4,5-dimethoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 2229299-38-9) is a chemical compound with the molecular formula C14H19NO6 and a molecular weight of 297.30 g/mol. IUPAC name: 3,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: YAJZXQICKPMEEJ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO6 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 3,4-dimethoxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | YAJZXQICKPMEEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC(=C1)C(=O)O)OC)OC |
Computed by PubChem (NCBI)