CAS 1076198-47-4 appears in our catalog under these names: 2-((2-(4-(1,2-Diphenylbut-1-en-1-yl)phenoxy)ethyl)(methyl)amino)-2-oxoethyl acetate, 98%, N-Methyl-N-(2-acetoxyacetyl) Tamoxifen (E/Z Mixture). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2mg, 5mg.
[2-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-oxoethyl] acetate (CAS 1076198-47-4) is a chemical compound with the molecular formula C29H31NO4 and a molecular weight of 457.6 g/mol. IUPAC name: [2-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-oxoethyl] acetate. InChIKey: YFZOMDVVUXMWFJ-OHYPFYFLSA-N.
| Molecular formula | C29H31NO4 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | [2-[2-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]ethyl-methylamino]-2-oxoethyl] acetate |
| InChIKey | YFZOMDVVUXMWFJ-OHYPFYFLSA-N |
| SMILES | CC/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCN(C)C(=O)COC(=O)C)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)