CAS 403661-80-3 is the registry number for (S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(4-(tert-butyl)phenyl)butanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-4-(4-tert-butylphenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 403661-80-3) is a chemical compound with the molecular formula C29H31NO4 and a molecular weight of 457.6 g/mol. IUPAC name: (3S)-4-(4-tert-butylphenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: HMXGIEACFDMWQS-NRFANRHFSA-N.
| Molecular formula | C29H31NO4 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | (3S)-4-(4-tert-butylphenyl)-3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | HMXGIEACFDMWQS-NRFANRHFSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)