Products 182167-02-8
CAS 182167-02-8 appears in our catalog under these names: Acolbifene, Acolbifene/ 98.17% (existing batch purity), Acolbifene, 99.42%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 1mg, 5mg, 10mg, 100mg, 10mM 1ml in dmso, 25mg, 50mg.
(2S)-3-(4-hydroxyphenyl)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-7-ol (CAS 182167-02-8) is a chemical compound with the molecular formula C29H31NO4 and a molecular weight of 457.6 g/mol. IUPAC name: (2S)-3-(4-hydroxyphenyl)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-7-ol. InChIKey: DUYNJNWVGIWJRI-LJAQVGFWSA-N.
| Molecular formula | C29H31NO4 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | (2S)-3-(4-hydroxyphenyl)-4-methyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2H-chromen-7-ol |
| InChIKey | DUYNJNWVGIWJRI-LJAQVGFWSA-N |
| SMILES | CC1=C([C@@H](OC2=C1C=CC(=C2)O)C3=CC=C(C=C3)OCCN4CCCCC4)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)