Products 1443752-77-9
CAS 1443752-77-9 appears in our catalog under these names: (R)–OP–1074, (R)-OP-1074, 98%, 98%, (R)-OP-1074, 98.24%, (R)-OP-1074, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 5 mg, 10 mg, 25 mg.
(2R)-3-(4-hydroxyphenyl)-4-methyl-2-[4-[2-[(3R)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-7-ol (CAS 1443752-77-9) is a chemical compound with the molecular formula C29H31NO4 and a molecular weight of 457.6 g/mol. IUPAC name: (2R)-3-(4-hydroxyphenyl)-4-methyl-2-[4-[2-[(3R)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-7-ol. InChIKey: KDVXAPCZVZMPMU-SONOPUAISA-N.
| Molecular formula | C29H31NO4 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | (2R)-3-(4-hydroxyphenyl)-4-methyl-2-[4-[2-[(3R)-3-methylpyrrolidin-1-yl]ethoxy]phenyl]-2H-chromen-7-ol |
| InChIKey | KDVXAPCZVZMPMU-SONOPUAISA-N |
| SMILES | C[C@@H]1CCN(C1)CCOC2=CC=C(C=C2)[C@@H]3C(=C(C4=C(O3)C=C(C=C4)O)C)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)