CAS 1076199-68-2 is the registry number for 3-(tert-Butyl)-5-(7-ethylbenzofuran-2-yl)oxazolidin-2-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-tert-butyl-5-(7-ethyl-1-benzofuran-2-yl)-1,3-oxazolidin-2-one (CAS 1076199-68-2) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: 3-tert-butyl-5-(7-ethyl-1-benzofuran-2-yl)-1,3-oxazolidin-2-one. InChIKey: AOVBZKJVAYVKSL-UHFFFAOYSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | 3-tert-butyl-5-(7-ethyl-1-benzofuran-2-yl)-1,3-oxazolidin-2-one |
| InChIKey | AOVBZKJVAYVKSL-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC2=C1OC(=C2)C3CN(C(=O)O3)C(C)(C)C |
Computed by PubChem (NCBI)