CAS 1160691-85-9 is the registry number for Ethyl 3-(4-(tert-butyl)phenyl)-5-methylisoxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(4-tert-butylphenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1160691-85-9) is a chemical compound with the molecular formula C17H21NO3 and a molecular weight of 287.35 g/mol. IUPAC name: ethyl 3-(4-tert-butylphenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: HSDONQADGYATQH-UHFFFAOYSA-N.
| Molecular formula | C17H21NO3 |
|---|---|
| Molecular weight | 287.35 g/mol |
| IUPAC name | ethyl 3-(4-tert-butylphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | HSDONQADGYATQH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=CC=C(C=C2)C(C)(C)C)C |
Computed by PubChem (NCBI)