Products 1076199-76-2

CAS 1076199-76-2 is the registry number for Terbinafine Impurity 18(Carboxyterbinafine Methyl Ester). Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Methyl (E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoate (CAS 1076199-76-2) is a chemical compound with the molecular formula C22H25NO2 and a molecular weight of 335.4 g/mol. IUPAC name: methyl (E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoate. InChIKey: WMUIXNIIZJVJPG-WEVVVXLNSA-N.

Identity
Molecular formulaC22H25NO2
Molecular weight335.4 g/mol
IUPAC namemethyl (E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoate
InChIKeyWMUIXNIIZJVJPG-WEVVVXLNSA-N
SMILESCC(C)(C#C/C=C/CN(C)CC1=CC=CC2=CC=CC=C21)C(=O)OC

Computed by PubChem (NCBI)