Products 2504202-00-8

CAS 2504202-00-8 is the registry number for Hex-5-enyl-methyl-carbamic acid 9h-fluoren-9-ylmethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

9H-fluoren-9-ylmethyl N-hex-5-enyl-N-methylcarbamate (CAS 2504202-00-8) is a chemical compound with the molecular formula C22H25NO2 and a molecular weight of 335.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-hex-5-enyl-N-methylcarbamate. InChIKey: SVMKNZYFTLMNMQ-UHFFFAOYSA-N.

Identity
Molecular formulaC22H25NO2
Molecular weight335.4 g/mol
IUPAC name9H-fluoren-9-ylmethyl N-hex-5-enyl-N-methylcarbamate
InChIKeySVMKNZYFTLMNMQ-UHFFFAOYSA-N
SMILESCN(CCCCC=C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13

Computed by PubChem (NCBI)