Products 148152-63-0
CAS 148152-63-0 appears in our catalog under these names: Napitane, Napitane/ 99.91% (existing batch purity). Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
(3R)-3-phenyl-1-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]pyrrolidine (CAS 148152-63-0) is a chemical compound with the molecular formula C22H25NO2 and a molecular weight of 335.4 g/mol. IUPAC name: (3R)-3-phenyl-1-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]pyrrolidine. InChIKey: HAEPGZUGYMHCJE-ROUUACIJSA-N.
| Molecular formula | C22H25NO2 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (3R)-3-phenyl-1-[[(6R)-6,7,8,9-tetrahydrobenzo[g][1,3]benzodioxol-6-yl]methyl]pyrrolidine |
| InChIKey | HAEPGZUGYMHCJE-ROUUACIJSA-N |
| SMILES | C1C[C@H](C2=C(C1)C3=C(C=C2)OCO3)CN4CC[C@@H](C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)